C24H30N2O4S — CID 55658528
3-methoxy-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-phenylmethoxybenzamide (PubChem CID 55658528) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-methoxy-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-phenylmethoxybenzamide.
| Compound Name | 3-methoxy-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 55658528 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-methoxy-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC2(N3CCOCC3)CCSC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-28-22-15-20(7-8-21(22)30-16-19-5-3-2-4-6-19)23(27)25-17-24(9-14-31-18-24)26-10-12-29-13-11-26/h2-8,15H,9-14,16-18H2,1H3,(H,25,27) |
| InChIKey | NHKCXURQMSBIJK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |