C17H26F3N5O2 — CID 86931397
1-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea (PubChem CID 86931397) has the molecular formula C17H26F3N5O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea.
| Compound Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
|---|---|
| PubChem CID | 86931397 |
| Molecular Formula | C17H26F3N5O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
| SMILES | CC(C)(CNC(=O)NCCNc1ccc(C(F)(F)F)cn1)N1CCOCC1 |
| InChI | InChI=1S/C17H26F3N5O2/c1-16(2,25-7-9-27-10-8-25)12-24-15(26)22-6-5-21-14-4-3-13(11-23-14)17(18,19)20/h3-4,11H,5-10,12H2,1-2H3,(H,21,23)(H2,22,24,26) |
| InChIKey | TUBVOJUHQFJHPT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|