C19H28F3N3O — CID 55684161
1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 55684161) has the molecular formula C19H28F3N3O and a molecular weight of 371.45 g/mol. Its IUPAC name is 1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 55684161 |
| Molecular Formula | C19H28F3N3O |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(C)(CNC(=O)NCCc1ccc(C(F)(F)F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H28F3N3O/c1-18(2,25-12-4-3-5-13-25)14-24-17(26)23-11-10-15-6-8-16(9-7-15)19(20,21)22/h6-9H,3-5,10-14H2,1-2H3,(H2,23,24,26) |
| InChIKey | INWOKYVNIVYEQX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |