C17H35N3O2 — CID 111503992
1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2-piperidin-1-ylpropyl)urea (PubChem CID 111503992) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2-piperidin-1-ylpropyl)urea.
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2-piperidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 111503992 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(2-methyl-2-piperidin-1-ylpropyl)urea |
| SMILES | CC(C)(CO)CCCNC(=O)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C17H35N3O2/c1-16(2,14-21)9-8-10-18-15(22)19-13-17(3,4)20-11-6-5-7-12-20/h21H,5-14H2,1-4H3,(H2,18,19,22) |
| InChIKey | AXFSJNYZVZLYJB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|