C19H37N3O2 — CID 110028311
1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 110028311) has the molecular formula C19H37N3O2 and a molecular weight of 339.52 g/mol. Its IUPAC name is 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea.
| Compound Name | 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 110028311 |
| Molecular Formula | C19H37N3O2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | CC(NC(=O)NCCCC(C)(C)CO)C1CCCN(C2CCC2)C1 |
| InChI | InChI=1S/C19H37N3O2/c1-15(16-7-5-12-22(13-16)17-8-4-9-17)21-18(24)20-11-6-10-19(2,3)14-23/h15-17,23H,4-14H2,1-3H3,(H2,20,21,24) |
| InChIKey | XQSWULKYQAMRSP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|