C18H16F3N5O — CID 48768630
1-quinolin-8-yl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea (PubChem CID 48768630) has the molecular formula C18H16F3N5O and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-quinolin-8-yl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea.
| Compound Name | 1-quinolin-8-yl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
|---|---|
| PubChem CID | 48768630 |
| Molecular Formula | C18H16F3N5O |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-quinolin-8-yl-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
| SMILES | O=C(NCCNc1ccc(C(F)(F)F)cn1)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C18H16F3N5O/c19-18(20,21)13-6-7-15(25-11-13)22-9-10-24-17(27)26-14-5-1-3-12-4-2-8-23-16(12)14/h1-8,11H,9-10H2,(H,22,25)(H2,24,26,27) |
| InChIKey | OXYDSOBZHXVROF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|