C9H11F3N4O — CID 83026552
N-[4-(trifluoromethyl)pyrimidin-2-yl]morpholin-4-amine (PubChem CID 83026552) has the molecular formula C9H11F3N4O and a molecular weight of 248.21 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)pyrimidin-2-yl]morpholin-4-amine.
| Compound Name | N-[4-(trifluoromethyl)pyrimidin-2-yl]morpholin-4-amine |
|---|---|
| PubChem CID | 83026552 |
| Molecular Formula | C9H11F3N4O |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-[4-(trifluoromethyl)pyrimidin-2-yl]morpholin-4-amine |
| SMILES | FC(F)(F)c1ccnc(NN2CCOCC2)n1 |
| InChI | InChI=1S/C9H11F3N4O/c10-9(11,12)7-1-2-13-8(14-7)15-16-3-5-17-6-4-16/h1-2H,3-6H2,(H,13,14,15) |
| InChIKey | YPWPHSOQTVNGLX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |