C11H15F3N4O — CID 95160947
N-[[(2R)-4-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 95160947) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is N-[[(2R)-4-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[[(2R)-4-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 95160947 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-[[(2R)-4-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CN1CCO[C@H](CNc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C11H15F3N4O/c1-18-4-5-19-8(7-18)6-16-10-15-3-2-9(17-10)11(12,13)14/h2-3,8H,4-7H2,1H3,(H,15,16,17)/t8-/m1/s1 |
| InChIKey | MPJFERUUKKHESS-MRVPVSSYSA-N |
| XLogP | 1.24 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |