C13H17N5O — CID 103204381
N-[(4-methylmorpholin-2-yl)methyl]-1,2,4-benzotriazin-3-amine (PubChem CID 103204381) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[(4-methylmorpholin-2-yl)methyl]-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[(4-methylmorpholin-2-yl)methyl]-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204381 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-[(4-methylmorpholin-2-yl)methyl]-1,2,4-benzotriazin-3-amine |
| SMILES | CN1CCOC(CNc2nnc3ccccc3n2)C1 |
| InChI | InChI=1S/C13H17N5O/c1-18-6-7-19-10(9-18)8-14-13-15-11-4-2-3-5-12(11)16-17-13/h2-5,10H,6-9H2,1H3,(H,14,15,17) |
| InChIKey | JXKFCZMZKJYBPH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |