C11H14ClF3N4O — CID 106768037
6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106768037) has the molecular formula C11H14ClF3N4O and a molecular weight of 310.71 g/mol. Its IUPAC name is 6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106768037 |
| Molecular Formula | C11H14ClF3N4O |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN1CCOC(CNc2cc(Cl)nc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C11H14ClF3N4O/c1-19-2-3-20-7(6-19)5-16-9-4-8(12)17-10(18-9)11(13,14)15/h4,7H,2-3,5-6H2,1H3,(H,16,17,18) |
| InChIKey | FBVJMCWPMRNCLF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |