C11H17ClN4OS — CID 80545786
6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80545786) has the molecular formula C11H17ClN4OS and a molecular weight of 288.80 g/mol. Its IUPAC name is 6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80545786 |
| Molecular Formula | C11H17ClN4OS |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 6-chloro-N-[(4-methylmorpholin-2-yl)methyl]-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NCC2CN(C)CCO2)n1 |
| InChI | InChI=1S/C11H17ClN4OS/c1-16-3-4-17-8(7-16)6-13-10-5-9(12)14-11(15-10)18-2/h5,8H,3-4,6-7H2,1-2H3,(H,13,14,15) |
| InChIKey | PAXJOOTZVICFDT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |