C20H21ClF3N3O3S — CID 55970560
1-(4-chlorophenyl)sulfonyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopentane-1-carboxamide (PubChem CID 55970560) has the molecular formula C20H21ClF3N3O3S and a molecular weight of 475.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55970560 |
| Molecular Formula | C20H21ClF3N3O3S |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopentane-1-carboxamide |
| SMILES | O=C(NCCNc1ncccc1C(F)(F)F)C1(S(=O)(=O)c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C20H21ClF3N3O3S/c21-14-5-7-15(8-6-14)31(29,30)19(9-1-2-10-19)18(28)27-13-12-26-17-16(20(22,23)24)4-3-11-25-17/h3-8,11H,1-2,9-10,12-13H2,(H,25,26)(H,27,28) |
| InChIKey | LDATVFMVERPLJJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|