C21H24ClNO5S — CID 46399799
1-(4-chlorophenyl)sulfonyl-N-[2-(3-methoxyphenoxy)ethyl]cyclopentane-1-carboxamide (PubChem CID 46399799) has the molecular formula C21H24ClNO5S and a molecular weight of 437.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[2-(3-methoxyphenoxy)ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(3-methoxyphenoxy)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 46399799 |
| Molecular Formula | C21H24ClNO5S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(3-methoxyphenoxy)ethyl]cyclopentane-1-carboxamide |
| SMILES | COc1cccc(OCCNC(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)c1 |
| InChI | InChI=1S/C21H24ClNO5S/c1-27-17-5-4-6-18(15-17)28-14-13-23-20(24)21(11-2-3-12-21)29(25,26)19-9-7-16(22)8-10-19/h4-10,15H,2-3,11-14H2,1H3,(H,23,24) |
| InChIKey | IVPFAIHRMPFULY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|