C16H20ClNO5S — CID 119237490
3-[[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]amino]-2-methylpropanoic acid (PubChem CID 119237490) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is 3-[[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119237490 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-[[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]amino]-2-methylpropanoic acid |
| SMILES | CC(CNC(=O)C1(S(=O)(=O)c2ccc(Cl)cc2)CCCC1)C(=O)O |
| InChI | InChI=1S/C16H20ClNO5S/c1-11(14(19)20)10-18-15(21)16(8-2-3-9-16)24(22,23)13-6-4-12(17)5-7-13/h4-7,11H,2-3,8-10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | ZYRSLUCMRYFNAQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |