C22H24F3NO3S — CID 67991885
N-(3-phenylpropyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide (PubChem CID 67991885) has the molecular formula C22H24F3NO3S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 67991885 |
| Molecular Formula | C22H24F3NO3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-(3-phenylpropyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C22H24F3NO3S/c23-22(24,25)18-10-12-19(13-11-18)30(28,29)21(14-4-5-15-21)20(27)26-16-6-9-17-7-2-1-3-8-17/h1-3,7-8,10-13H,4-6,9,14-16H2,(H,26,27) |
| InChIKey | GMIDNLNBHZDGJZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|