C20H21F3N2OS — CID 67991854
N-(3-phenylpropyl)-1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]cyclobutane-1-carboxamide (PubChem CID 67991854) has the molecular formula C20H21F3N2OS and a molecular weight of 394.46 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]cyclobutane-1-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 67991854 |
| Molecular Formula | C20H21F3N2OS |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-(3-phenylpropyl)-1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]cyclobutane-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1(Sc2ccc(C(F)(F)F)cn2)CCC1 |
| InChI | InChI=1S/C20H21F3N2OS/c21-20(22,23)16-9-10-17(25-14-16)27-19(11-5-12-19)18(26)24-13-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-10,14H,4-5,8,11-13H2,(H,24,26) |
| InChIKey | HMJUHMMTSRGYCZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|