C24H32N2O3S — CID 39642729
1-(3,4-dimethylphenyl)sulfonyl-N-[3-(N-methylanilino)propyl]cyclopentane-1-carboxamide (PubChem CID 39642729) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-N-[3-(N-methylanilino)propyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-N-[3-(N-methylanilino)propyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 39642729 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-N-[3-(N-methylanilino)propyl]cyclopentane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)C2(C(=O)NCCCN(C)c3ccccc3)CCCC2)cc1C |
| InChI | InChI=1S/C24H32N2O3S/c1-19-12-13-22(18-20(19)2)30(28,29)24(14-7-8-15-24)23(27)25-16-9-17-26(3)21-10-5-4-6-11-21/h4-6,10-13,18H,7-9,14-17H2,1-3H3,(H,25,27) |
| InChIKey | WBFFCKVNLREQFL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|