C31H38N2O4S — CID 142186305
N-hydroxy-4-[methylidene-[3-methyl-4-[3-(N-methyl-3-phenylanilino)propyl]phenyl]-oxo-λ6-sulfanyl]oxepane-4-carboxamide (PubChem CID 142186305) has the molecular formula C31H38N2O4S and a molecular weight of 534.72 g/mol. Its IUPAC name is N-hydroxy-4-[methylidene-[3-methyl-4-[3-(N-methyl-3-phenylanilino)propyl]phenyl]-oxo-λ6-sulfanyl]oxepane-4-carboxamide.
| Compound Name | N-hydroxy-4-[methylidene-[3-methyl-4-[3-(N-methyl-3-phenylanilino)propyl]phenyl]-oxo-λ6-sulfanyl]oxepane-4-carboxamide |
|---|---|
| PubChem CID | 142186305 |
| Molecular Formula | C31H38N2O4S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | N-hydroxy-4-[methylidene-[3-methyl-4-[3-(N-methyl-3-phenylanilino)propyl]phenyl]-oxo-λ6-sulfanyl]oxepane-4-carboxamide |
| SMILES | C=S(=O)(c1ccc(CCCN(C)c2cccc(-c3ccccc3)c2)c(C)c1)C1(C(=O)NO)CCCOCC1 |
| InChI | InChI=1S/C31H38N2O4S/c1-24-22-29(38(3,36)31(30(34)32-35)17-9-20-37-21-18-31)16-15-25(24)13-8-19-33(2)28-14-7-12-27(23-28)26-10-5-4-6-11-26/h4-7,10-12,14-16,22-23,35H,3,8-9,13,17-21H2,1-2H3,(H,32,34) |
| InChIKey | QXEBJKJHUPNTIB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|