C24H30N2O5S2 — CID 11684589
1-methyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 11684589) has the molecular formula C24H30N2O5S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 1-methyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-methyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 11684589 |
| Molecular Formula | C24H30N2O5S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-methyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(Sc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H30N2O5S2/c1-26-16-14-24(15-17-26,23(27)25-31-22-9-5-6-18-30-22)33(28,29)21-12-10-20(11-13-21)32-19-7-3-2-4-8-19/h2-4,7-8,10-13,22H,5-6,9,14-18H2,1H3,(H,25,27) |
| InChIKey | SFUGLBJRTQCVTC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|