C29H40N2O8S — CID 46938910
1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 46938910) has the molecular formula C29H40N2O8S and a molecular weight of 576.71 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46938910 |
| Molecular Formula | C29H40N2O8S |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-(4-propan-2-yloxyphenoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(Oc3ccc(OC(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H40N2O8S/c1-22(2)37-23-7-9-24(10-8-23)38-25-11-13-26(14-12-25)40(33,34)29(15-17-31(18-16-29)19-21-35-3)28(32)30-39-27-6-4-5-20-36-27/h7-14,22,27H,4-6,15-21H2,1-3H3,(H,30,32) |
| InChIKey | VKBUWIRCCFNJJX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|