C35H42N2O6S — CID 20620255
1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 20620255) has the molecular formula C35H42N2O6S and a molecular weight of 618.80 g/mol. Its IUPAC name is 1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20620255 |
| Molecular Formula | C35H42N2O6S |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 1-cyclopropyl-N-(oxan-2-yloxy)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(OCCCc3cccc(-c4ccccc4)c3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C35H42N2O6S/c38-34(36-43-33-13-4-5-24-42-33)35(20-22-37(23-21-35)30-14-15-30)44(39,40)32-18-16-31(17-19-32)41-25-7-9-27-8-6-12-29(26-27)28-10-2-1-3-11-28/h1-3,6,8,10-12,16-19,26,30,33H,4-5,7,9,13-15,20-25H2,(H,36,38) |
| InChIKey | NFCOBCBEOJHATB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|