C29H39N3O5S — CID 20620249
1-cyclopropyl-N-hydroxy-4-[4-[3-(3-piperidin-1-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 20620249) has the molecular formula C29H39N3O5S and a molecular weight of 541.71 g/mol. Its IUPAC name is 1-cyclopropyl-N-hydroxy-4-[4-[3-(3-piperidin-1-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-hydroxy-4-[4-[3-(3-piperidin-1-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20620249 |
| Molecular Formula | C29H39N3O5S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 1-cyclopropyl-N-hydroxy-4-[4-[3-(3-piperidin-1-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCc3cccc(N4CCCCC4)c3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C29H39N3O5S/c33-28(30-34)29(15-19-32(20-16-29)24-9-10-24)38(35,36)27-13-11-26(12-14-27)37-21-5-7-23-6-4-8-25(22-23)31-17-2-1-3-18-31/h4,6,8,11-14,22,24,34H,1-3,5,7,9-10,15-21H2,(H,30,33) |
| InChIKey | PFSLUBHJEACHCY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|