C28H36ClN3O7S — CID 159120672
1-cyclopropyl-N-hydroxy-4-[4-[(Z)-6-hydroxyimino-5-(4-methoxyphenyl)hex-4-enoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 159120672) has the molecular formula C28H36ClN3O7S and a molecular weight of 594.13 g/mol. Its IUPAC name is 1-cyclopropyl-N-hydroxy-4-[4-[(Z)-6-hydroxyimino-5-(4-methoxyphenyl)hex-4-enoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-cyclopropyl-N-hydroxy-4-[4-[(Z)-6-hydroxyimino-5-(4-methoxyphenyl)hex-4-enoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 159120672 |
| Molecular Formula | C28H36ClN3O7S |
| Molecular Weight | 594.13 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 1-cyclopropyl-N-hydroxy-4-[4-[(Z)-6-hydroxyimino-5-(4-methoxyphenyl)hex-4-enoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | COc1ccc(/C(C=NO)=C/CCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCN(C4CC4)CC3)cc2)cc1.Cl |
| InChI | InChI=1S/C28H35N3O7S.ClH/c1-37-24-9-5-21(6-10-24)22(20-29-33)4-2-3-19-38-25-11-13-26(14-12-25)39(35,36)28(27(32)30-34)15-17-31(18-16-28)23-7-8-23;/h4-6,9-14,20,23,33-34H,2-3,7-8,15-19H2,1H3,(H,30,32);1H/b22-4+,29-20?; |
| InChIKey | VTYQDFMTQBUPJX-UCDHCIHVSA-N |
| XLogP | 4.10 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|