C31H35N3O6S — CID 20620470
4-[4-[3-[3-(4-cyanophenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 20620470) has the molecular formula C31H35N3O6S and a molecular weight of 577.70 g/mol. Its IUPAC name is 4-[4-[3-[3-(4-cyanophenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(4-cyanophenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20620470 |
| Molecular Formula | C31H35N3O6S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 4-[4-[3-[3-(4-cyanophenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(OCCCc3cccc(-c4ccc(C#N)cc4)c3)cc2)CC1 |
| InChI | InChI=1S/C31H35N3O6S/c1-39-21-19-34-17-15-31(16-18-34,30(35)33-36)41(37,38)29-13-11-28(12-14-29)40-20-3-5-24-4-2-6-27(22-24)26-9-7-25(23-32)8-10-26/h2,4,6-14,22,36H,3,5,15-21H2,1H3,(H,33,35) |
| InChIKey | HLPYFWQXRVDUJZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|