C32H37NO4S — CID 67553182
ethyl 1-cyclopropyl-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylate (PubChem CID 67553182) has the molecular formula C32H37NO4S and a molecular weight of 531.72 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 67553182 |
| Molecular Formula | C32H37NO4S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | ethyl 1-cyclopropyl-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(S(=O)c2ccc(OCCCc3cccc(-c4ccccc4)c3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C32H37NO4S/c1-2-36-31(34)32(19-21-33(22-20-32)28-13-14-28)38(35)30-17-15-29(16-18-30)37-23-7-9-25-8-6-12-27(24-25)26-10-4-3-5-11-26/h3-6,8,10-12,15-18,24,28H,2,7,9,13-14,19-23H2,1H3 |
| InChIKey | VLOIWUOGRFDBGE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|