C21H31NO2S — CID 25386680
ethyl 4-(3-phenylpropyl)-1-[(3R)-thiolan-3-yl]piperidine-4-carboxylate (PubChem CID 25386680) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is ethyl 4-(3-phenylpropyl)-1-[(3R)-thiolan-3-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-(3-phenylpropyl)-1-[(3R)-thiolan-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 25386680 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | ethyl 4-(3-phenylpropyl)-1-[(3R)-thiolan-3-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCCc2ccccc2)CCN([C@@H]2CCSC2)CC1 |
| InChI | InChI=1S/C21H31NO2S/c1-2-24-20(23)21(11-6-9-18-7-4-3-5-8-18)12-14-22(15-13-21)19-10-16-25-17-19/h3-5,7-8,19H,2,6,9-17H2,1H3/t19-/m1/s1 |
| InChIKey | VINANCUAJXIRCO-LJQANCHMSA-N |
| XLogP | 4.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |