C23H29NO5 — CID 42527197
ethyl 1-(5-methoxyfuran-2-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate (PubChem CID 42527197) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 1-(5-methoxyfuran-2-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-methoxyfuran-2-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42527197 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | ethyl 1-(5-methoxyfuran-2-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCCc2ccccc2)CCN(C(=O)c2ccc(OC)o2)CC1 |
| InChI | InChI=1S/C23H29NO5/c1-3-28-22(26)23(13-7-10-18-8-5-4-6-9-18)14-16-24(17-15-23)21(25)19-11-12-20(27-2)29-19/h4-6,8-9,11-12H,3,7,10,13-17H2,1-2H3 |
| InChIKey | SCWPPCNFMMUFCW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |