C24H33NO3 — CID 45238431
ethyl 1-(cyclohex-3-ene-1-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate (PubChem CID 45238431) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is ethyl 1-(cyclohex-3-ene-1-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(cyclohex-3-ene-1-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 45238431 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | ethyl 1-(cyclohex-3-ene-1-carbonyl)-4-(3-phenylpropyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCCc2ccccc2)CCN(C(=O)C2CC=CCC2)CC1 |
| InChI | InChI=1S/C24H33NO3/c1-2-28-23(27)24(15-9-12-20-10-5-3-6-11-20)16-18-25(19-17-24)22(26)21-13-7-4-8-14-21/h3-7,10-11,21H,2,8-9,12-19H2,1H3 |
| InChIKey | JGBNNUIXGYXZRD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|