C23H28F3NO3 — CID 42591640
ethyl 1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate (PubChem CID 42591640) has the molecular formula C23H28F3NO3 and a molecular weight of 423.48 g/mol. Its IUPAC name is ethyl 1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42591640 |
| Molecular Formula | C23H28F3NO3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethyl 1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2C(F)(F)F)CCN(C(=O)[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C23H28F3NO3/c1-2-30-21(29)22(16-18-10-6-7-11-19(18)23(24,25)26)12-14-27(15-13-22)20(28)17-8-4-3-5-9-17/h3-4,6-7,10-11,17H,2,5,8-9,12-16H2,1H3/t17-/m0/s1 |
| InChIKey | GNAYZABSEDKGIR-KRWDZBQOSA-N |
| XLogP | 4.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|