C27H33N3O2 — CID 110247282
1-(cyclohex-3-ene-1-carbonyl)-N-ethyl-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 110247282) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-(cyclohex-3-ene-1-carbonyl)-N-ethyl-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(cyclohex-3-ene-1-carbonyl)-N-ethyl-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110247282 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-(cyclohex-3-ene-1-carbonyl)-N-ethyl-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1(Cc2ccccc2-c2ccncc2)CCN(C(=O)C2CC=CCC2)CC1 |
| InChI | InChI=1S/C27H33N3O2/c1-2-29-26(32)27(14-18-30(19-15-27)25(31)22-8-4-3-5-9-22)20-23-10-6-7-11-24(23)21-12-16-28-17-13-21/h3-4,6-7,10-13,16-17,22H,2,5,8-9,14-15,18-20H2,1H3,(H,29,32) |
| InChIKey | NZEHZHQKIUJICN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|