C28H33FN2O2 — CID 155982797
1-(cyclohex-3-ene-1-carbonyl)-4-[[2-(3-fluorophenyl)phenyl]methyl]-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 155982797) has the molecular formula C28H33FN2O2 and a molecular weight of 448.58 g/mol. Its IUPAC name is 1-(cyclohex-3-ene-1-carbonyl)-4-[[2-(3-fluorophenyl)phenyl]methyl]-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-(cyclohex-3-ene-1-carbonyl)-4-[[2-(3-fluorophenyl)phenyl]methyl]-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155982797 |
| Molecular Formula | C28H33FN2O2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-(cyclohex-3-ene-1-carbonyl)-4-[[2-(3-fluorophenyl)phenyl]methyl]-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1(Cc2ccccc2-c2cccc(F)c2)CCN(C(=O)C2CC=CCC2)CC1 |
| InChI | InChI=1S/C28H33FN2O2/c1-30(2)27(33)28(15-17-31(18-16-28)26(32)21-9-4-3-5-10-21)20-23-11-6-7-14-25(23)22-12-8-13-24(29)19-22/h3-4,6-8,11-14,19,21H,5,9-10,15-18,20H2,1-2H3 |
| InChIKey | NNYOJAXCMNGLAI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|