C28H33FN2O2 — CID 155982799
1-(2-cyclopent-2-en-1-ylacetyl)-N-ethyl-4-[[2-(3-fluorophenyl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 155982799) has the molecular formula C28H33FN2O2 and a molecular weight of 448.58 g/mol. Its IUPAC name is 1-(2-cyclopent-2-en-1-ylacetyl)-N-ethyl-4-[[2-(3-fluorophenyl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-cyclopent-2-en-1-ylacetyl)-N-ethyl-4-[[2-(3-fluorophenyl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155982799 |
| Molecular Formula | C28H33FN2O2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-(2-cyclopent-2-en-1-ylacetyl)-N-ethyl-4-[[2-(3-fluorophenyl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1(Cc2ccccc2-c2cccc(F)c2)CCN(C(=O)CC2C=CCC2)CC1 |
| InChI | InChI=1S/C28H33FN2O2/c1-2-30-27(33)28(14-16-31(17-15-28)26(32)18-21-8-3-4-9-21)20-23-10-5-6-13-25(23)22-11-7-12-24(29)19-22/h3,5-8,10-13,19,21H,2,4,9,14-18,20H2,1H3,(H,30,33) |
| InChIKey | ASNRQTWFXPRCBH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|