C20H25FN2O2 — CID 71979323
2-cyclopent-2-en-1-yl-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 71979323) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-cyclopent-2-en-1-yl-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 71979323 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCCN(C(=O)CC2C=CCC2)CC1 |
| InChI | InChI=1S/C20H25FN2O2/c21-18-8-3-7-17(13-18)15-20(25)23-10-4-9-22(11-12-23)19(24)14-16-5-1-2-6-16/h1,3,5,7-8,13,16H,2,4,6,9-12,14-15H2 |
| InChIKey | QWIDTOKWNZSQAJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|