C20H31ClFN3O2 — CID 119754789
7-amino-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]heptan-1-one;hydrochloride (PubChem CID 119754789) has the molecular formula C20H31ClFN3O2 and a molecular weight of 399.94 g/mol. Its IUPAC name is 7-amino-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]heptan-1-one;hydrochloride.
| Compound Name | 7-amino-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]heptan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119754789 |
| Molecular Formula | C20H31ClFN3O2 |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 7-amino-1-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepan-1-yl]heptan-1-one;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)N1CCCN(C(=O)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H30FN3O2.ClH/c21-18-8-5-7-17(15-18)16-20(26)24-12-6-11-23(13-14-24)19(25)9-3-1-2-4-10-22;/h5,7-8,15H,1-4,6,9-14,16,22H2;1H |
| InChIKey | PQYMDMOQSGPKEP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|