C19H28FN3O2 — CID 119710558
7-amino-1-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]heptan-1-one (PubChem CID 119710558) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is 7-amino-1-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]heptan-1-one.
| Compound Name | 7-amino-1-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 119710558 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 7-amino-1-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]heptan-1-one |
| SMILES | NCCCCCCC(=O)N1CCCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H28FN3O2/c20-17-8-5-7-16(15-17)19(25)23-12-6-11-22(13-14-23)18(24)9-3-1-2-4-10-21/h5,7-8,15H,1-4,6,9-14,21H2 |
| InChIKey | XOUDSHXIGSVQEG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|