C21H22F2N2O2 — CID 110666015
3-(2-fluorophenyl)-1-[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]propan-1-one (PubChem CID 110666015) has the molecular formula C21H22F2N2O2 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(2-fluorophenyl)-1-[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110666015 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccccc1F)N1CCN(C(=O)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H22F2N2O2/c22-18-6-3-4-16(14-18)15-21(27)25-12-10-24(11-13-25)20(26)9-8-17-5-1-2-7-19(17)23/h1-7,14H,8-13,15H2 |
| InChIKey | XARRMVTWVQVUCN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |