C20H26N2O3 — CID 94811563
2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]ethanone (PubChem CID 94811563) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 94811563 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]ethanone |
| SMILES | COc1cccc(CC(=O)N2CCN(C(=O)C[C@@H]3C=CCC3)CC2)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-25-18-8-4-7-17(13-18)15-20(24)22-11-9-21(10-12-22)19(23)14-16-5-2-3-6-16/h2,4-5,7-8,13,16H,3,6,9-12,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | BFXROEPGAZCASF-MRXNPFEDSA-N |
| XLogP | 2.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|