C24H29N3O6S2 — CID 22985922
4-[4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanylphenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 22985922) has the molecular formula C24H29N3O6S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 4-[4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanylphenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanylphenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 22985922 |
| Molecular Formula | C24H29N3O6S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 4-[4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanylphenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(Sc3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H29N3O6S2/c1-18(28)26-12-14-27(15-13-26)19-2-4-20(5-3-19)34-21-6-8-22(9-7-21)35(31,32)24(23(29)25-30)10-16-33-17-11-24/h2-9,30H,10-17H2,1H3,(H,25,29) |
| InChIKey | NILQXOSGSSWDGB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|