C27H33N3O6S — CID 46891522
4-[4-[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 46891522) has the molecular formula C27H33N3O6S and a molecular weight of 527.64 g/mol. Its IUPAC name is 4-[4-[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 46891522 |
| Molecular Formula | C27H33N3O6S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 4-[4-[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(C1CCN(c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)CC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H33N3O6S/c31-25(30-16-9-20-3-1-2-4-22(20)19-30)21-10-14-29(15-11-21)23-5-7-24(8-6-23)37(34,35)27(26(32)28-33)12-17-36-18-13-27/h1-8,21,33H,9-19H2,(H,28,32) |
| InChIKey | ISXZSJVTKFNYSR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|