C30H40N4O6S — CID 46891583
N-hydroxy-4-[4-[4-[4-(2-phenylethyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 46891583) has the molecular formula C30H40N4O6S and a molecular weight of 584.74 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-[4-(2-phenylethyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-[4-(2-phenylethyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 46891583 |
| Molecular Formula | C30H40N4O6S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | N-hydroxy-4-[4-[4-[4-(2-phenylethyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(C1CCN(c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)CC1)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C30H40N4O6S/c35-28(34-20-18-32(19-21-34)15-10-24-4-2-1-3-5-24)25-11-16-33(17-12-25)26-6-8-27(9-7-26)41(38,39)30(29(36)31-37)13-22-40-23-14-30/h1-9,25,37H,10-23H2,(H,31,36) |
| InChIKey | QJQSFVGRKOULTN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|