C41H53N5O6S2 — CID 142247533
9H-fluoren-9-ylmethyl 4-[[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenoxy]sulfanyl-methylamino]-4-(hydroxycarbamoyl)piperidine-1-carboxylate;sulfane (PubChem CID 142247533) has the molecular formula C41H53N5O6S2 and a molecular weight of 776.04 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenoxy]sulfanyl-methylamino]-4-(hydroxycarbamoyl)piperidine-1-carboxylate;sulfane.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenoxy]sulfanyl-methylamino]-4-(hydroxycarbamoyl)piperidine-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 142247533 |
| Molecular Formula | C41H53N5O6S2 |
| Molecular Weight | 776.04 g/mol |
| Exact Mass | 775.34 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenoxy]sulfanyl-methylamino]-4-(hydroxycarbamoyl)piperidine-1-carboxylate;sulfane |
| SMILES | CC1CC(C)CN(C(=O)C2CCN(c3ccc(OSN(C)C4(C(=O)NO)CCN(C(=O)OCC5c6ccccc6-c6ccccc65)CC4)cc3)CC2)C1.S |
| InChI | InChI=1S/C41H51N5O6S.H2S/c1-28-24-29(2)26-46(25-28)38(47)30-16-20-44(21-17-30)31-12-14-32(15-13-31)52-53-43(3)41(39(48)42-50)18-22-45(23-19-41)40(49)51-27-37-35-10-6-4-8-33(35)34-9-5-7-11-36(34)37;/h4-15,28-30,37,50H,16-27H2,1-3H3,(H,42,48);1H2 |
| InChIKey | JYDZZIFMUZPLEW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.04 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|