C25H35N5O2 — CID 78852026
[4-(adamantane-1-carbonyl)piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone (PubChem CID 78852026) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyl)piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone.
| Compound Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 78852026 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(c2cnccn2)CC1)N1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C25H35N5O2/c31-23(21-1-5-28(6-2-21)22-17-26-3-4-27-22)29-7-9-30(10-8-29)24(32)25-14-18-11-19(15-25)13-20(12-18)16-25/h3-4,17-21H,1-2,5-16H2 |
| InChIKey | KRXFDJQOCKSHOX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |