C26H32N4O2 — CID 98606495
[(5S,7S)-3-(4-methoxyphenyl)-1-adamantyl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone (PubChem CID 98606495) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is [(5S,7S)-3-(4-methoxyphenyl)-1-adamantyl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [(5S,7S)-3-(4-methoxyphenyl)-1-adamantyl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 98606495 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(5S,7S)-3-(4-methoxyphenyl)-1-adamantyl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(C23C[C@@H]4C[C@H](CC(C(=O)N5CCN(c6cnccn6)CC5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H32N4O2/c1-32-22-4-2-21(3-5-22)25-13-19-12-20(14-25)16-26(15-19,18-25)24(31)30-10-8-29(9-11-30)23-17-27-6-7-28-23/h2-7,17,19-20H,8-16,18H2,1H3/t19-,20-,25?,26?/m0/s1 |
| InChIKey | SXHAIYYPHDEZHI-XCGOXOSTSA-N |
| XLogP | 3.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |