C23H29NO5 — CID 119357938
4-[3-(4-methoxyphenyl)adamantane-1-carbonyl]morpholine-2-carboxylic acid (PubChem CID 119357938) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)adamantane-1-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[3-(4-methoxyphenyl)adamantane-1-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119357938 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)adamantane-1-carbonyl]morpholine-2-carboxylic acid |
| SMILES | COc1ccc(C23CC4CC(CC(C(=O)N5CCOC(C(=O)O)C5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H29NO5/c1-28-18-4-2-17(3-5-18)22-9-15-8-16(10-22)12-23(11-15,14-22)21(27)24-6-7-29-19(13-24)20(25)26/h2-5,15-16,19H,6-14H2,1H3,(H,25,26) |
| InChIKey | ZMGWQZDPRMHZBC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |