C19H26N2O4 — CID 94370776
(2R)-4-[1-(4-methoxyphenyl)cyclohexanecarbonyl]morpholine-2-carboxamide (PubChem CID 94370776) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R)-4-[1-(4-methoxyphenyl)cyclohexanecarbonyl]morpholine-2-carboxamide.
| Compound Name | (2R)-4-[1-(4-methoxyphenyl)cyclohexanecarbonyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 94370776 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2R)-4-[1-(4-methoxyphenyl)cyclohexanecarbonyl]morpholine-2-carboxamide |
| SMILES | COc1ccc(C2(C(=O)N3CCO[C@@H](C(N)=O)C3)CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-24-15-7-5-14(6-8-15)19(9-3-2-4-10-19)18(23)21-11-12-25-16(13-21)17(20)22/h5-8,16H,2-4,9-13H2,1H3,(H2,20,22)/t16-/m1/s1 |
| InChIKey | ZHFDOIADQVZTDH-MRXNPFEDSA-N |
| XLogP | 1.61 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |