C25H30ClNO2 — CID 121147027
[1-(4-chlorophenyl)cyclopentyl]-[3-(4-methoxyphenyl)azepan-1-yl]methanone (PubChem CID 121147027) has the molecular formula C25H30ClNO2 and a molecular weight of 411.97 g/mol. Its IUPAC name is [1-(4-chlorophenyl)cyclopentyl]-[3-(4-methoxyphenyl)azepan-1-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)cyclopentyl]-[3-(4-methoxyphenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 121147027 |
| Molecular Formula | C25H30ClNO2 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [1-(4-chlorophenyl)cyclopentyl]-[3-(4-methoxyphenyl)azepan-1-yl]methanone |
| SMILES | COc1ccc(C2CCCCN(C(=O)C3(c4ccc(Cl)cc4)CCCC3)C2)cc1 |
| InChI | InChI=1S/C25H30ClNO2/c1-29-23-13-7-19(8-14-23)20-6-2-5-17-27(18-20)24(28)25(15-3-4-16-25)21-9-11-22(26)12-10-21/h7-14,20H,2-6,15-18H2,1H3 |
| InChIKey | FBSAHHDFSUWFQF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |