C24H31NO4 — CID 119248000
2-[4-[3-(4-methylphenyl)adamantane-1-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 119248000) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[4-[3-(4-methylphenyl)adamantane-1-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-(4-methylphenyl)adamantane-1-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248000 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[4-[3-(4-methylphenyl)adamantane-1-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)N5CCOC(CC(=O)O)C5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-16-2-4-19(5-3-16)23-10-17-8-18(11-23)13-24(12-17,15-23)22(28)25-6-7-29-20(14-25)9-21(26)27/h2-5,17-18,20H,6-15H2,1H3,(H,26,27) |
| InChIKey | OMVXJUSNFJMORF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |