C24H30N2O7S — CID 54272642
N-(oxan-2-yloxy)-2-[4-[(4-phenoxyphenyl)sulfonylamino]oxan-4-yl]acetamide (PubChem CID 54272642) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-2-[4-[(4-phenoxyphenyl)sulfonylamino]oxan-4-yl]acetamide.
| Compound Name | N-(oxan-2-yloxy)-2-[4-[(4-phenoxyphenyl)sulfonylamino]oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 54272642 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-(oxan-2-yloxy)-2-[4-[(4-phenoxyphenyl)sulfonylamino]oxan-4-yl]acetamide |
| SMILES | O=C(CC1(NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)CCOCC1)NOC1CCCCO1 |
| InChI | InChI=1S/C24H30N2O7S/c27-22(25-33-23-8-4-5-15-31-23)18-24(13-16-30-17-14-24)26-34(28,29)21-11-9-20(10-12-21)32-19-6-2-1-3-7-19/h1-3,6-7,9-12,23,26H,4-5,8,13-18H2,(H,25,27) |
| InChIKey | RLFRJDHCQQDRSU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|