C26H36N2O5S — CID 10277997
1-benzyl-4-[[4-(2-ethylbutoxy)phenyl]methylsulfonyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 10277997) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is 1-benzyl-4-[[4-(2-ethylbutoxy)phenyl]methylsulfonyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-benzyl-4-[[4-(2-ethylbutoxy)phenyl]methylsulfonyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10277997 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 1-benzyl-4-[[4-(2-ethylbutoxy)phenyl]methylsulfonyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | CCC(CC)COc1ccc(CS(=O)(=O)C2(C(=O)NO)CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H36N2O5S/c1-3-21(4-2)19-33-24-12-10-23(11-13-24)20-34(31,32)26(25(29)27-30)14-16-28(17-15-26)18-22-8-6-5-7-9-22/h5-13,21,30H,3-4,14-20H2,1-2H3,(H,27,29) |
| InChIKey | PEDSKLOAEBSSOK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|