C18H29ClN4O5S — CID 162326281
N-hydroxy-4-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 162326281) has the molecular formula C18H29ClN4O5S and a molecular weight of 448.97 g/mol. Its IUPAC name is N-hydroxy-4-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162326281 |
| Molecular Formula | C18H29ClN4O5S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-hydroxy-4-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | CCCc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)nc1.Cl |
| InChI | InChI=1S/C18H28N4O5S.ClH/c1-2-3-15-4-5-16(19-14-15)21-8-10-22(11-9-21)28(25,26)18(17(23)20-24)6-12-27-13-7-18;/h4-5,14,24H,2-3,6-13H2,1H3,(H,20,23);1H |
| InChIKey | OIVANYSXCNAASB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|